C17H18F2IN3O3 — CID 174404685
3-fluoro-2-(2-fluoro-4-iodoanilino)-N-[2-hydroxy-3-(methylamino)propoxy]benzamide (PubChem CID 174404685) has the molecular formula C17H18F2IN3O3 and a molecular weight of 477.25 g/mol. Its IUPAC name is 3-fluoro-2-(2-fluoro-4-iodoanilino)-N-[2-hydroxy-3-(methylamino)propoxy]benzamide.
| Compound Name | 3-fluoro-2-(2-fluoro-4-iodoanilino)-N-[2-hydroxy-3-(methylamino)propoxy]benzamide |
|---|---|
| PubChem CID | 174404685 |
| Molecular Formula | C17H18F2IN3O3 |
| Molecular Weight | 477.25 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 3-fluoro-2-(2-fluoro-4-iodoanilino)-N-[2-hydroxy-3-(methylamino)propoxy]benzamide |
| SMILES | CNCC(O)CONC(=O)c1cccc(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C17H18F2IN3O3/c1-21-8-11(24)9-26-23-17(25)12-3-2-4-13(18)16(12)22-15-6-5-10(20)7-14(15)19/h2-7,11,21-22,24H,8-9H2,1H3,(H,23,25) |
| InChIKey | FHDJQADRTDCRPQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|