C16H12F3IN2O5 — CID 169445374
2,3,3-trideuterio-3-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxy-2-hydroxypropanoic acid (PubChem CID 169445374) has the molecular formula C16H12F3IN2O5 and a molecular weight of 499.20 g/mol. Its IUPAC name is 2,3,3-trideuterio-3-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxy-2-hydroxypropanoic acid.
| Compound Name | 2,3,3-trideuterio-3-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxy-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 169445374 |
| Molecular Formula | C16H12F3IN2O5 |
| Molecular Weight | 499.20 g/mol |
| Exact Mass | 498.99 |
| IUPAC Name | 2,3,3-trideuterio-3-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxy-2-hydroxypropanoic acid |
| SMILES | [2H]C([2H])(ONC(=O)c1ccc(F)c(F)c1Nc1ccc(I)cc1F)C([2H])(O)C(=O)O |
| InChI | InChI=1S/C16H12F3IN2O5/c17-9-3-2-8(15(24)22-27-6-12(23)16(25)26)14(13(9)19)21-11-4-1-7(20)5-10(11)18/h1-5,12,21,23H,6H2,(H,22,24)(H,25,26)/i6D2,12D |
| InChIKey | ZRQGYXROXZTNHA-GUJSMHJNSA-N |
| XLogP | 2.56 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|