C20H20F3IN2O4 — CID 87690816
6-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxy-2-methylhexanoic acid (PubChem CID 87690816) has the molecular formula C20H20F3IN2O4 and a molecular weight of 536.29 g/mol. Its IUPAC name is 6-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxy-2-methylhexanoic acid.
| Compound Name | 6-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxy-2-methylhexanoic acid |
|---|---|
| PubChem CID | 87690816 |
| Molecular Formula | C20H20F3IN2O4 |
| Molecular Weight | 536.29 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | 6-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxy-2-methylhexanoic acid |
| SMILES | CC(CCCCONC(=O)c1ccc(F)c(F)c1Nc1ccc(I)cc1F)C(=O)O |
| InChI | InChI=1S/C20H20F3IN2O4/c1-11(20(28)29)4-2-3-9-30-26-19(27)13-6-7-14(21)17(23)18(13)25-16-8-5-12(24)10-15(16)22/h5-8,10-11,25H,2-4,9H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | IWFFTOGHIBKLRU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|