C19H21F3N2O4 — CID 10216123
3,4-difluoro-2-[2-fluoro-4-(3-methoxypropyl)anilino]-N-(2-hydroxyethoxy)benzamide (PubChem CID 10216123) has the molecular formula C19H21F3N2O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is 3,4-difluoro-2-[2-fluoro-4-(3-methoxypropyl)anilino]-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 3,4-difluoro-2-[2-fluoro-4-(3-methoxypropyl)anilino]-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 10216123 |
| Molecular Formula | C19H21F3N2O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3,4-difluoro-2-[2-fluoro-4-(3-methoxypropyl)anilino]-N-(2-hydroxyethoxy)benzamide |
| SMILES | COCCCc1ccc(Nc2c(C(=O)NOCCO)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C19H21F3N2O4/c1-27-9-2-3-12-4-7-16(15(21)11-12)23-18-13(5-6-14(20)17(18)22)19(26)24-28-10-8-25/h4-7,11,23,25H,2-3,8-10H2,1H3,(H,24,26) |
| InChIKey | BLKAWOWOMYXIDE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|