C18H12F10N2O3 — CID 23504106
3,4-difluoro-2-[2-fluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-N-(2-hydroxyethoxy)benzamide (PubChem CID 23504106) has the molecular formula C18H12F10N2O3 and a molecular weight of 494.29 g/mol. Its IUPAC name is 3,4-difluoro-2-[2-fluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 3,4-difluoro-2-[2-fluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 23504106 |
| Molecular Formula | C18H12F10N2O3 |
| Molecular Weight | 494.29 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 3,4-difluoro-2-[2-fluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-N-(2-hydroxyethoxy)benzamide |
| SMILES | O=C(NOCCO)c1ccc(F)c(F)c1Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C18H12F10N2O3/c19-10-3-2-9(15(32)30-33-6-5-31)14(13(10)21)29-12-4-1-8(7-11(12)20)16(22,17(23,24)25)18(26,27)28/h1-4,7,29,31H,5-6H2,(H,30,32) |
| InChIKey | AJYLHNAKDFAXDE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.29 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|