C18H19F3N2O3 — CID 10126260
3,4-difluoro-2-(2-fluoro-4-propylanilino)-N-(2-hydroxyethoxy)benzamide (PubChem CID 10126260) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-propylanilino)-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-propylanilino)-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 10126260 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-propylanilino)-N-(2-hydroxyethoxy)benzamide |
| SMILES | CCCc1ccc(Nc2c(C(=O)NOCCO)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C18H19F3N2O3/c1-2-3-11-4-7-15(14(20)10-11)22-17-12(5-6-13(19)16(17)21)18(25)23-26-9-8-24/h4-7,10,22,24H,2-3,8-9H2,1H3,(H,23,25) |
| InChIKey | YNNNHTWSCUOBCU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|