C20H20F3IN2O3 — CID 22025689
N-(2-ethenoxyethoxy)-3,4-difluoro-2-[2-fluoro-4-(3-iodopropyl)anilino]benzamide (PubChem CID 22025689) has the molecular formula C20H20F3IN2O3 and a molecular weight of 520.29 g/mol. Its IUPAC name is N-(2-ethenoxyethoxy)-3,4-difluoro-2-[2-fluoro-4-(3-iodopropyl)anilino]benzamide.
| Compound Name | N-(2-ethenoxyethoxy)-3,4-difluoro-2-[2-fluoro-4-(3-iodopropyl)anilino]benzamide |
|---|---|
| PubChem CID | 22025689 |
| Molecular Formula | C20H20F3IN2O3 |
| Molecular Weight | 520.29 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | N-(2-ethenoxyethoxy)-3,4-difluoro-2-[2-fluoro-4-(3-iodopropyl)anilino]benzamide |
| SMILES | C=COCCONC(=O)c1ccc(F)c(F)c1Nc1ccc(CCCI)cc1F |
| InChI | InChI=1S/C20H20F3IN2O3/c1-2-28-10-11-29-26-20(27)14-6-7-15(21)18(23)19(14)25-17-8-5-13(4-3-9-24)12-16(17)22/h2,5-8,12,25H,1,3-4,9-11H2,(H,26,27) |
| InChIKey | YLUKBBMSUMYDGU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.29 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|