C18H15FIN3O3S — CID 86656247
N-(2-ethenoxyethoxy)-4-(2-fluoro-4-iodoanilino)-1,2-benzothiazole-5-carboxamide (PubChem CID 86656247) has the molecular formula C18H15FIN3O3S and a molecular weight of 499.31 g/mol. Its IUPAC name is N-(2-ethenoxyethoxy)-4-(2-fluoro-4-iodoanilino)-1,2-benzothiazole-5-carboxamide.
| Compound Name | N-(2-ethenoxyethoxy)-4-(2-fluoro-4-iodoanilino)-1,2-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 86656247 |
| Molecular Formula | C18H15FIN3O3S |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 498.99 |
| IUPAC Name | N-(2-ethenoxyethoxy)-4-(2-fluoro-4-iodoanilino)-1,2-benzothiazole-5-carboxamide |
| SMILES | C=COCCONC(=O)c1ccc2sncc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C18H15FIN3O3S/c1-2-25-7-8-26-23-18(24)12-4-6-16-13(10-21-27-16)17(12)22-15-5-3-11(20)9-14(15)19/h2-6,9-10,22H,1,7-8H2,(H,23,24) |
| InChIKey | NHESFFFPRSVOHM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|