C15H12FIN4O4S — CID 59703868
3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-7-oxo-6H-thieno[2,3-d]pyridazine-2-carboxamide (PubChem CID 59703868) has the molecular formula C15H12FIN4O4S and a molecular weight of 490.25 g/mol. Its IUPAC name is 3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-7-oxo-6H-thieno[2,3-d]pyridazine-2-carboxamide.
| Compound Name | 3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-7-oxo-6H-thieno[2,3-d]pyridazine-2-carboxamide |
|---|---|
| PubChem CID | 59703868 |
| Molecular Formula | C15H12FIN4O4S |
| Molecular Weight | 490.25 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | 3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-7-oxo-6H-thieno[2,3-d]pyridazine-2-carboxamide |
| SMILES | O=C(NOCCO)c1sc2c(=O)[nH]ncc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C15H12FIN4O4S/c16-9-5-7(17)1-2-10(9)19-11-8-6-18-20-14(23)12(8)26-13(11)15(24)21-25-4-3-22/h1-2,5-6,19,22H,3-4H2,(H,20,23)(H,21,24) |
| InChIKey | RWCUPTRTZMEIOB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|