C15H13F2IN2O3 — CID 10224849
4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide (PubChem CID 10224849) has the molecular formula C15H13F2IN2O3 and a molecular weight of 434.18 g/mol. Its IUPAC name is 4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 10224849 |
| Molecular Formula | C15H13F2IN2O3 |
| Molecular Weight | 434.18 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | 4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide |
| SMILES | O=C(NOCCO)c1ccc(F)cc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C15H13F2IN2O3/c16-9-1-3-11(15(22)20-23-6-5-21)14(7-9)19-13-4-2-10(18)8-12(13)17/h1-4,7-8,19,21H,5-6H2,(H,20,22) |
| InChIKey | FQELXZARENTIKS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.18 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|