C18H19ClFIN2O4 — CID 22286598
2-(2-chloro-4-iodoanilino)-4-fluoro-N-[2-(2-methoxyethoxy)ethoxy]benzamide (PubChem CID 22286598) has the molecular formula C18H19ClFIN2O4 and a molecular weight of 508.72 g/mol. Its IUPAC name is 2-(2-chloro-4-iodoanilino)-4-fluoro-N-[2-(2-methoxyethoxy)ethoxy]benzamide.
| Compound Name | 2-(2-chloro-4-iodoanilino)-4-fluoro-N-[2-(2-methoxyethoxy)ethoxy]benzamide |
|---|---|
| PubChem CID | 22286598 |
| Molecular Formula | C18H19ClFIN2O4 |
| Molecular Weight | 508.72 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | 2-(2-chloro-4-iodoanilino)-4-fluoro-N-[2-(2-methoxyethoxy)ethoxy]benzamide |
| SMILES | COCCOCCONC(=O)c1ccc(F)cc1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C18H19ClFIN2O4/c1-25-6-7-26-8-9-27-23-18(24)14-4-2-12(20)10-17(14)22-16-5-3-13(21)11-15(16)19/h2-5,10-11,22H,6-9H2,1H3,(H,23,24) |
| InChIKey | ZJSNESBYZRZOJB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.72 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|