C17H16Cl2FIN2O3 — CID 22286580
5-chloro-2-(2-chloro-4-iodoanilino)-N-(2-ethoxyethoxy)-4-fluorobenzamide (PubChem CID 22286580) has the molecular formula C17H16Cl2FIN2O3 and a molecular weight of 513.13 g/mol. Its IUPAC name is 5-chloro-2-(2-chloro-4-iodoanilino)-N-(2-ethoxyethoxy)-4-fluorobenzamide.
| Compound Name | 5-chloro-2-(2-chloro-4-iodoanilino)-N-(2-ethoxyethoxy)-4-fluorobenzamide |
|---|---|
| PubChem CID | 22286580 |
| Molecular Formula | C17H16Cl2FIN2O3 |
| Molecular Weight | 513.13 g/mol |
| Exact Mass | 511.96 |
| IUPAC Name | 5-chloro-2-(2-chloro-4-iodoanilino)-N-(2-ethoxyethoxy)-4-fluorobenzamide |
| SMILES | CCOCCONC(=O)c1cc(Cl)c(F)cc1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C17H16Cl2FIN2O3/c1-2-25-5-6-26-23-17(24)11-8-12(18)14(20)9-16(11)22-15-4-3-10(21)7-13(15)19/h3-4,7-9,22H,2,5-6H2,1H3,(H,23,24) |
| InChIKey | WGLRHGOCGPMHON-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.13 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|