C18H18ClF2IN2O3 — CID 22286180
5-chloro-4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(3-hydroxy-3-methylbutoxy)benzamide (PubChem CID 22286180) has the molecular formula C18H18ClF2IN2O3 and a molecular weight of 510.71 g/mol. Its IUPAC name is 5-chloro-4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(3-hydroxy-3-methylbutoxy)benzamide.
| Compound Name | 5-chloro-4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(3-hydroxy-3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 22286180 |
| Molecular Formula | C18H18ClF2IN2O3 |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.00 |
| IUPAC Name | 5-chloro-4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(3-hydroxy-3-methylbutoxy)benzamide |
| SMILES | CC(C)(O)CCONC(=O)c1cc(Cl)c(F)cc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C18H18ClF2IN2O3/c1-18(2,26)5-6-27-24-17(25)11-8-12(19)13(20)9-16(11)23-15-4-3-10(22)7-14(15)21/h3-4,7-9,23,26H,5-6H2,1-2H3,(H,24,25) |
| InChIKey | ACJUDTFSQACDDJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|