C19H21F2IN2O3 — CID 22286142
4,5-difluoro-N-(3-hydroxy-2,2-dimethylpropoxy)-2-(4-iodo-2-methylanilino)benzamide (PubChem CID 22286142) has the molecular formula C19H21F2IN2O3 and a molecular weight of 490.29 g/mol. Its IUPAC name is 4,5-difluoro-N-(3-hydroxy-2,2-dimethylpropoxy)-2-(4-iodo-2-methylanilino)benzamide.
| Compound Name | 4,5-difluoro-N-(3-hydroxy-2,2-dimethylpropoxy)-2-(4-iodo-2-methylanilino)benzamide |
|---|---|
| PubChem CID | 22286142 |
| Molecular Formula | C19H21F2IN2O3 |
| Molecular Weight | 490.29 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 4,5-difluoro-N-(3-hydroxy-2,2-dimethylpropoxy)-2-(4-iodo-2-methylanilino)benzamide |
| SMILES | Cc1cc(I)ccc1Nc1cc(F)c(F)cc1C(=O)NOCC(C)(C)CO |
| InChI | InChI=1S/C19H21F2IN2O3/c1-11-6-12(22)4-5-16(11)23-17-8-15(21)14(20)7-13(17)18(26)24-27-10-19(2,3)9-25/h4-8,23,25H,9-10H2,1-3H3,(H,24,26) |
| InChIKey | WCUSCSZSFMUFLI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|