C19H19F2IN2O3 — CID 22286539
N-[cyclobutyl(hydroxy)methoxy]-4,5-difluoro-2-(4-iodo-2-methylanilino)benzamide (PubChem CID 22286539) has the molecular formula C19H19F2IN2O3 and a molecular weight of 488.27 g/mol. Its IUPAC name is N-[cyclobutyl(hydroxy)methoxy]-4,5-difluoro-2-(4-iodo-2-methylanilino)benzamide.
| Compound Name | N-[cyclobutyl(hydroxy)methoxy]-4,5-difluoro-2-(4-iodo-2-methylanilino)benzamide |
|---|---|
| PubChem CID | 22286539 |
| Molecular Formula | C19H19F2IN2O3 |
| Molecular Weight | 488.27 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | N-[cyclobutyl(hydroxy)methoxy]-4,5-difluoro-2-(4-iodo-2-methylanilino)benzamide |
| SMILES | Cc1cc(I)ccc1Nc1cc(F)c(F)cc1C(=O)NOC(O)C1CCC1 |
| InChI | InChI=1S/C19H19F2IN2O3/c1-10-7-12(22)5-6-16(10)23-17-9-15(21)14(20)8-13(17)18(25)24-27-19(26)11-3-2-4-11/h5-9,11,19,23,26H,2-4H2,1H3,(H,24,25) |
| InChIKey | COTIAHHRQMZALQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|