C17H13Cl2F2IN2O3 — CID 22286441
5-chloro-2-(2-chloro-4-iodoanilino)-N-[cyclopropyl(hydroxy)methoxy]-3,4-difluorobenzamide (PubChem CID 22286441) has the molecular formula C17H13Cl2F2IN2O3 and a molecular weight of 529.11 g/mol. Its IUPAC name is 5-chloro-2-(2-chloro-4-iodoanilino)-N-[cyclopropyl(hydroxy)methoxy]-3,4-difluorobenzamide.
| Compound Name | 5-chloro-2-(2-chloro-4-iodoanilino)-N-[cyclopropyl(hydroxy)methoxy]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 22286441 |
| Molecular Formula | C17H13Cl2F2IN2O3 |
| Molecular Weight | 529.11 g/mol |
| Exact Mass | 527.93 |
| IUPAC Name | 5-chloro-2-(2-chloro-4-iodoanilino)-N-[cyclopropyl(hydroxy)methoxy]-3,4-difluorobenzamide |
| SMILES | O=C(NOC(O)C1CC1)c1cc(Cl)c(F)c(F)c1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C17H13Cl2F2IN2O3/c18-10-5-8(22)3-4-12(10)23-15-9(6-11(19)13(20)14(15)21)16(25)24-27-17(26)7-1-2-7/h3-7,17,23,26H,1-2H2,(H,24,25) |
| InChIKey | XHXYSLKBQTWECZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.11 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|