C18H15Cl2F2IN2O3 — CID 22285993
5-chloro-2-(2-chloro-4-iodoanilino)-N-(1-cyclopropyl-2-hydroxyethoxy)-3,4-difluorobenzamide (PubChem CID 22285993) has the molecular formula C18H15Cl2F2IN2O3 and a molecular weight of 543.14 g/mol. Its IUPAC name is 5-chloro-2-(2-chloro-4-iodoanilino)-N-(1-cyclopropyl-2-hydroxyethoxy)-3,4-difluorobenzamide.
| Compound Name | 5-chloro-2-(2-chloro-4-iodoanilino)-N-(1-cyclopropyl-2-hydroxyethoxy)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 22285993 |
| Molecular Formula | C18H15Cl2F2IN2O3 |
| Molecular Weight | 543.14 g/mol |
| Exact Mass | 541.95 |
| IUPAC Name | 5-chloro-2-(2-chloro-4-iodoanilino)-N-(1-cyclopropyl-2-hydroxyethoxy)-3,4-difluorobenzamide |
| SMILES | O=C(NOC(CO)C1CC1)c1cc(Cl)c(F)c(F)c1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C18H15Cl2F2IN2O3/c19-11-5-9(23)3-4-13(11)24-17-10(6-12(20)15(21)16(17)22)18(27)25-28-14(7-26)8-1-2-8/h3-6,8,14,24,26H,1-2,7H2,(H,25,27) |
| InChIKey | ILRSZKFEQOQURI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.14 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|