C18H18ClF2IN2O4 — CID 22285951
5-chloro-3,4-difluoro-N-(3-hydroxy-2-methoxypropoxy)-2-(4-iodo-2-methylanilino)benzamide (PubChem CID 22285951) has the molecular formula C18H18ClF2IN2O4 and a molecular weight of 526.71 g/mol. Its IUPAC name is 5-chloro-3,4-difluoro-N-(3-hydroxy-2-methoxypropoxy)-2-(4-iodo-2-methylanilino)benzamide.
| Compound Name | 5-chloro-3,4-difluoro-N-(3-hydroxy-2-methoxypropoxy)-2-(4-iodo-2-methylanilino)benzamide |
|---|---|
| PubChem CID | 22285951 |
| Molecular Formula | C18H18ClF2IN2O4 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.00 |
| IUPAC Name | 5-chloro-3,4-difluoro-N-(3-hydroxy-2-methoxypropoxy)-2-(4-iodo-2-methylanilino)benzamide |
| SMILES | COC(CO)CONC(=O)c1cc(Cl)c(F)c(F)c1Nc1ccc(I)cc1C |
| InChI | InChI=1S/C18H18ClF2IN2O4/c1-9-5-10(22)3-4-14(9)23-17-12(6-13(19)15(20)16(17)21)18(26)24-28-8-11(7-25)27-2/h3-6,11,23,25H,7-8H2,1-2H3,(H,24,26) |
| InChIKey | PVCNVOKAQCCNOD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|