C19H18ClF2IN2O3 — CID 87738692
5-chloro-3,4-difluoro-N-[[1-(hydroxymethyl)cyclopropyl]methoxy]-2-(4-iodo-2-methylanilino)benzamide (PubChem CID 87738692) has the molecular formula C19H18ClF2IN2O3 and a molecular weight of 522.72 g/mol. Its IUPAC name is 5-chloro-3,4-difluoro-N-[[1-(hydroxymethyl)cyclopropyl]methoxy]-2-(4-iodo-2-methylanilino)benzamide.
| Compound Name | 5-chloro-3,4-difluoro-N-[[1-(hydroxymethyl)cyclopropyl]methoxy]-2-(4-iodo-2-methylanilino)benzamide |
|---|---|
| PubChem CID | 87738692 |
| Molecular Formula | C19H18ClF2IN2O3 |
| Molecular Weight | 522.72 g/mol |
| Exact Mass | 522.00 |
| IUPAC Name | 5-chloro-3,4-difluoro-N-[[1-(hydroxymethyl)cyclopropyl]methoxy]-2-(4-iodo-2-methylanilino)benzamide |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)NOCC2(CO)CC2)cc(Cl)c(F)c1F |
| InChI | InChI=1S/C19H18ClF2IN2O3/c1-10-6-11(23)2-3-14(10)24-17-12(7-13(20)15(21)16(17)22)18(27)25-28-9-19(8-26)4-5-19/h2-3,6-7,24,26H,4-5,8-9H2,1H3,(H,25,27) |
| InChIKey | ONXNBVFRFVLLCW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|