C18H16F3IN2O3 — CID 22286146
3,4,5-trifluoro-N-[1-(hydroxymethyl)cyclopropyl]oxy-2-(4-iodo-2-methylanilino)benzamide (PubChem CID 22286146) has the molecular formula C18H16F3IN2O3 and a molecular weight of 492.24 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[1-(hydroxymethyl)cyclopropyl]oxy-2-(4-iodo-2-methylanilino)benzamide.
| Compound Name | 3,4,5-trifluoro-N-[1-(hydroxymethyl)cyclopropyl]oxy-2-(4-iodo-2-methylanilino)benzamide |
|---|---|
| PubChem CID | 22286146 |
| Molecular Formula | C18H16F3IN2O3 |
| Molecular Weight | 492.24 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | 3,4,5-trifluoro-N-[1-(hydroxymethyl)cyclopropyl]oxy-2-(4-iodo-2-methylanilino)benzamide |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)NOC2(CO)CC2)cc(F)c(F)c1F |
| InChI | InChI=1S/C18H16F3IN2O3/c1-9-6-10(22)2-3-13(9)23-16-11(7-12(19)14(20)15(16)21)17(26)24-27-18(8-25)4-5-18/h2-3,6-7,23,25H,4-5,8H2,1H3,(H,24,26) |
| InChIKey | NOZOQSQUTWMJIB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.24 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|