C24H22F2IN3O4S — CID 22707220
N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodo-2-methylanilino)-5-(phenylsulfamoyl)benzamide (PubChem CID 22707220) has the molecular formula C24H22F2IN3O4S and a molecular weight of 613.42 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodo-2-methylanilino)-5-(phenylsulfamoyl)benzamide.
| Compound Name | N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodo-2-methylanilino)-5-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 22707220 |
| Molecular Formula | C24H22F2IN3O4S |
| Molecular Weight | 613.42 g/mol |
| Exact Mass | 613.03 |
| IUPAC Name | N-(cyclopropylmethoxy)-3,4-difluoro-2-(4-iodo-2-methylanilino)-5-(phenylsulfamoyl)benzamide |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)NOCC2CC2)cc(S(=O)(=O)Nc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C24H22F2IN3O4S/c1-14-11-16(27)9-10-19(14)28-23-18(24(31)29-34-13-15-7-8-15)12-20(21(25)22(23)26)35(32,33)30-17-5-3-2-4-6-17/h2-6,9-12,15,28,30H,7-8,13H2,1H3,(H,29,31) |
| InChIKey | VRZYOPFDTNKQOR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|