C22H24FIN4O3 — CID 58781123
N-(cyclopropylmethoxy)-7-fluoro-3-(3-hydroxypropyl)-6-(4-iodo-2-methylanilino)benzimidazole-5-carboxamide (PubChem CID 58781123) has the molecular formula C22H24FIN4O3 and a molecular weight of 538.36 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-7-fluoro-3-(3-hydroxypropyl)-6-(4-iodo-2-methylanilino)benzimidazole-5-carboxamide.
| Compound Name | N-(cyclopropylmethoxy)-7-fluoro-3-(3-hydroxypropyl)-6-(4-iodo-2-methylanilino)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 58781123 |
| Molecular Formula | C22H24FIN4O3 |
| Molecular Weight | 538.36 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | N-(cyclopropylmethoxy)-7-fluoro-3-(3-hydroxypropyl)-6-(4-iodo-2-methylanilino)benzimidazole-5-carboxamide |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)NOCC2CC2)cc2c(ncn2CCCO)c1F |
| InChI | InChI=1S/C22H24FIN4O3/c1-13-9-15(24)5-6-17(13)26-20-16(22(30)27-31-11-14-3-4-14)10-18-21(19(20)23)25-12-28(18)7-2-8-29/h5-6,9-10,12,14,26,29H,2-4,7-8,11H2,1H3,(H,27,30) |
| InChIKey | PBHKUSGLPKQMHO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|