C28H36FN5O2S — CID 154471189
N-(cyclopropylmethoxy)-6-(2,4-dimethylanilino)-7-fluoro-3-(4-thiomorpholin-4-ylbutyl)benzimidazole-5-carboxamide (PubChem CID 154471189) has the molecular formula C28H36FN5O2S and a molecular weight of 525.69 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-6-(2,4-dimethylanilino)-7-fluoro-3-(4-thiomorpholin-4-ylbutyl)benzimidazole-5-carboxamide.
| Compound Name | N-(cyclopropylmethoxy)-6-(2,4-dimethylanilino)-7-fluoro-3-(4-thiomorpholin-4-ylbutyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 154471189 |
| Molecular Formula | C28H36FN5O2S |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | N-(cyclopropylmethoxy)-6-(2,4-dimethylanilino)-7-fluoro-3-(4-thiomorpholin-4-ylbutyl)benzimidazole-5-carboxamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCC3CC3)cc3c(ncn3CCCCN3CCSCC3)c2F)c(C)c1 |
| InChI | InChI=1S/C28H36FN5O2S/c1-19-5-8-23(20(2)15-19)31-26-22(28(35)32-36-17-21-6-7-21)16-24-27(25(26)29)30-18-34(24)10-4-3-9-33-11-13-37-14-12-33/h5,8,15-16,18,21,31H,3-4,6-7,9-14,17H2,1-2H3,(H,32,35) |
| InChIKey | NOAKFASURUCEIC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|