C27H31ClFN5O3 — CID 130240606
6-(4-chloro-2-methylanilino)-N-(cyclopropylmethoxy)-3-[4-(2,3-dihydro-1,4-oxazin-4-yl)butyl]-7-fluorobenzimidazole-5-carboxamide (PubChem CID 130240606) has the molecular formula C27H31ClFN5O3 and a molecular weight of 528.03 g/mol. Its IUPAC name is 6-(4-chloro-2-methylanilino)-N-(cyclopropylmethoxy)-3-[4-(2,3-dihydro-1,4-oxazin-4-yl)butyl]-7-fluorobenzimidazole-5-carboxamide.
| Compound Name | 6-(4-chloro-2-methylanilino)-N-(cyclopropylmethoxy)-3-[4-(2,3-dihydro-1,4-oxazin-4-yl)butyl]-7-fluorobenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 130240606 |
| Molecular Formula | C27H31ClFN5O3 |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 6-(4-chloro-2-methylanilino)-N-(cyclopropylmethoxy)-3-[4-(2,3-dihydro-1,4-oxazin-4-yl)butyl]-7-fluorobenzimidazole-5-carboxamide |
| SMILES | Cc1cc(Cl)ccc1Nc1c(C(=O)NOCC2CC2)cc2c(ncn2CCCCN2C=COCC2)c1F |
| InChI | InChI=1S/C27H31ClFN5O3/c1-18-14-20(28)6-7-22(18)31-25-21(27(35)32-37-16-19-4-5-19)15-23-26(24(25)29)30-17-34(23)9-3-2-8-33-10-12-36-13-11-33/h6-7,10,12,14-15,17,19,31H,2-5,8-9,11,13,16H2,1H3,(H,32,35) |
| InChIKey | GTCYYJIHRDDJJK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|