C23H27ClFN5O — CID 130240962
6-(4-chloro-2-methylanilino)-7-fluoro-3-(4-pyrrolidin-1-ylbutyl)benzimidazole-5-carboxamide (PubChem CID 130240962) has the molecular formula C23H27ClFN5O and a molecular weight of 443.95 g/mol. Its IUPAC name is 6-(4-chloro-2-methylanilino)-7-fluoro-3-(4-pyrrolidin-1-ylbutyl)benzimidazole-5-carboxamide.
| Compound Name | 6-(4-chloro-2-methylanilino)-7-fluoro-3-(4-pyrrolidin-1-ylbutyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 130240962 |
| Molecular Formula | C23H27ClFN5O |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 6-(4-chloro-2-methylanilino)-7-fluoro-3-(4-pyrrolidin-1-ylbutyl)benzimidazole-5-carboxamide |
| SMILES | Cc1cc(Cl)ccc1Nc1c(C(N)=O)cc2c(ncn2CCCCN2CCCC2)c1F |
| InChI | InChI=1S/C23H27ClFN5O/c1-15-12-16(24)6-7-18(15)28-21-17(23(26)31)13-19-22(20(21)25)27-14-30(19)11-5-4-10-29-8-2-3-9-29/h6-7,12-14,28H,2-5,8-11H2,1H3,(H2,26,31) |
| InChIKey | MLFSQUSECFQHLF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|