C23H26BrFN4O2S — CID 142808179
6-(4-bromo-2-methylanilino)-7-fluoro-3-[4-(1-oxo-1,4-thiazinan-4-yl)butyl]benzimidazole-5-carbaldehyde (PubChem CID 142808179) has the molecular formula C23H26BrFN4O2S and a molecular weight of 521.46 g/mol. Its IUPAC name is 6-(4-bromo-2-methylanilino)-7-fluoro-3-[4-(1-oxo-1,4-thiazinan-4-yl)butyl]benzimidazole-5-carbaldehyde.
| Compound Name | 6-(4-bromo-2-methylanilino)-7-fluoro-3-[4-(1-oxo-1,4-thiazinan-4-yl)butyl]benzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 142808179 |
| Molecular Formula | C23H26BrFN4O2S |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 6-(4-bromo-2-methylanilino)-7-fluoro-3-[4-(1-oxo-1,4-thiazinan-4-yl)butyl]benzimidazole-5-carbaldehyde |
| SMILES | Cc1cc(Br)ccc1Nc1c(C=O)cc2c(ncn2CCCCN2CCS(=O)CC2)c1F |
| InChI | InChI=1S/C23H26BrFN4O2S/c1-16-12-18(24)4-5-19(16)27-22-17(14-30)13-20-23(21(22)25)26-15-29(20)7-3-2-6-28-8-10-32(31)11-9-28/h4-5,12-15,27H,2-3,6-11H2,1H3 |
| InChIKey | IJHWEOXHGQMMIC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|