C17H13BrCl2FN3O2 — CID 69087613
methyl 6-(4-bromo-2-chloroanilino)-3-(2-chloroethyl)-7-fluorobenzimidazole-5-carboxylate (PubChem CID 69087613) has the molecular formula C17H13BrCl2FN3O2 and a molecular weight of 461.12 g/mol. Its IUPAC name is methyl 6-(4-bromo-2-chloroanilino)-3-(2-chloroethyl)-7-fluorobenzimidazole-5-carboxylate.
| Compound Name | methyl 6-(4-bromo-2-chloroanilino)-3-(2-chloroethyl)-7-fluorobenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 69087613 |
| Molecular Formula | C17H13BrCl2FN3O2 |
| Molecular Weight | 461.12 g/mol |
| Exact Mass | 458.96 |
| IUPAC Name | methyl 6-(4-bromo-2-chloroanilino)-3-(2-chloroethyl)-7-fluorobenzimidazole-5-carboxylate |
| SMILES | COC(=O)c1cc2c(ncn2CCCl)c(F)c1Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C17H13BrCl2FN3O2/c1-26-17(25)10-7-13-16(22-8-24(13)5-4-19)14(21)15(10)23-12-3-2-9(18)6-11(12)20/h2-3,6-8,23H,4-5H2,1H3 |
| InChIKey | XKUGEPWYEWGFAE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.12 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|