C22H25BrClFN4O4 — CID 89134708
6-(4-bromo-2-chloroanilino)-3-(4-ethoxybutyl)-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide (PubChem CID 89134708) has the molecular formula C22H25BrClFN4O4 and a molecular weight of 543.82 g/mol. Its IUPAC name is 6-(4-bromo-2-chloroanilino)-3-(4-ethoxybutyl)-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide.
| Compound Name | 6-(4-bromo-2-chloroanilino)-3-(4-ethoxybutyl)-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 89134708 |
| Molecular Formula | C22H25BrClFN4O4 |
| Molecular Weight | 543.82 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 6-(4-bromo-2-chloroanilino)-3-(4-ethoxybutyl)-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide |
| SMILES | CCOCCCCn1cnc2c(F)c(Nc3ccc(Br)cc3Cl)c(C(=O)NOCCO)cc21 |
| InChI | InChI=1S/C22H25BrClFN4O4/c1-2-32-9-4-3-7-29-13-26-21-18(29)12-15(22(31)28-33-10-8-30)20(19(21)25)27-17-6-5-14(23)11-16(17)24/h5-6,11-13,27,30H,2-4,7-10H2,1H3,(H,28,31) |
| InChIKey | UNQKMCHVPWCQNT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.82 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|