C21H22BrCl2N4O2P — CID 129042136
6-(4-bromo-2-chloroanilino)-3-(3-chloropropyl)-N-(cyclopropylmethoxy)-7-phosphanylbenzimidazole-5-carboxamide (PubChem CID 129042136) has the molecular formula C21H22BrCl2N4O2P and a molecular weight of 544.22 g/mol. Its IUPAC name is 6-(4-bromo-2-chloroanilino)-3-(3-chloropropyl)-N-(cyclopropylmethoxy)-7-phosphanylbenzimidazole-5-carboxamide.
| Compound Name | 6-(4-bromo-2-chloroanilino)-3-(3-chloropropyl)-N-(cyclopropylmethoxy)-7-phosphanylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 129042136 |
| Molecular Formula | C21H22BrCl2N4O2P |
| Molecular Weight | 544.22 g/mol |
| Exact Mass | 542.00 |
| IUPAC Name | 6-(4-bromo-2-chloroanilino)-3-(3-chloropropyl)-N-(cyclopropylmethoxy)-7-phosphanylbenzimidazole-5-carboxamide |
| SMILES | O=C(NOCC1CC1)c1cc2c(ncn2CCCCl)c(P)c1Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C21H22BrCl2N4O2P/c22-13-4-5-16(15(24)8-13)26-18-14(21(29)27-30-10-12-2-3-12)9-17-19(20(18)31)25-11-28(17)7-1-6-23/h4-5,8-9,11-12,26H,1-3,6-7,10,31H2,(H,27,29) |
| InChIKey | WGXGTTOVJRIWMA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.22 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|