C24H26BrFN4O2 — CID 58890614
6-(4-bromo-2-methylanilino)-N-(cyclopropylmethoxy)-7-fluoro-3-pent-4-enylbenzimidazole-5-carboxamide (PubChem CID 58890614) has the molecular formula C24H26BrFN4O2 and a molecular weight of 501.40 g/mol. Its IUPAC name is 6-(4-bromo-2-methylanilino)-N-(cyclopropylmethoxy)-7-fluoro-3-pent-4-enylbenzimidazole-5-carboxamide.
| Compound Name | 6-(4-bromo-2-methylanilino)-N-(cyclopropylmethoxy)-7-fluoro-3-pent-4-enylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 58890614 |
| Molecular Formula | C24H26BrFN4O2 |
| Molecular Weight | 501.40 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 6-(4-bromo-2-methylanilino)-N-(cyclopropylmethoxy)-7-fluoro-3-pent-4-enylbenzimidazole-5-carboxamide |
| SMILES | C=CCCCn1cnc2c(F)c(Nc3ccc(Br)cc3C)c(C(=O)NOCC3CC3)cc21 |
| InChI | InChI=1S/C24H26BrFN4O2/c1-3-4-5-10-30-14-27-23-20(30)12-18(24(31)29-32-13-16-6-7-16)22(21(23)26)28-19-9-8-17(25)11-15(19)2/h3,8-9,11-12,14,16,28H,1,4-7,10,13H2,2H3,(H,29,31) |
| InChIKey | KHNUUHJZXDCSCB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.40 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|