C22H22FIN4O4 — CID 11478420
methyl 2-[6-(cyclopropylmethoxycarbamoyl)-4-fluoro-5-(4-iodo-2-methylanilino)benzimidazol-1-yl]acetate (PubChem CID 11478420) has the molecular formula C22H22FIN4O4 and a molecular weight of 552.34 g/mol. Its IUPAC name is methyl 2-[6-(cyclopropylmethoxycarbamoyl)-4-fluoro-5-(4-iodo-2-methylanilino)benzimidazol-1-yl]acetate.
| Compound Name | methyl 2-[6-(cyclopropylmethoxycarbamoyl)-4-fluoro-5-(4-iodo-2-methylanilino)benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 11478420 |
| Molecular Formula | C22H22FIN4O4 |
| Molecular Weight | 552.34 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | methyl 2-[6-(cyclopropylmethoxycarbamoyl)-4-fluoro-5-(4-iodo-2-methylanilino)benzimidazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cnc2c(F)c(Nc3ccc(I)cc3C)c(C(=O)NOCC3CC3)cc21 |
| InChI | InChI=1S/C22H22FIN4O4/c1-12-7-14(24)5-6-16(12)26-20-15(22(30)27-32-10-13-3-4-13)8-17-21(19(20)23)25-11-28(17)9-18(29)31-2/h5-8,11,13,26H,3-4,9-10H2,1-2H3,(H,27,30) |
| InChIKey | LDJHQRBCEDHRDT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|