C16H15FIN5O — CID 58781096
7-fluoro-6-(4-iodo-2-methylanilino)-3-methylbenzimidazole-5-carbohydrazide (PubChem CID 58781096) has the molecular formula C16H15FIN5O and a molecular weight of 439.23 g/mol. Its IUPAC name is 7-fluoro-6-(4-iodo-2-methylanilino)-3-methylbenzimidazole-5-carbohydrazide.
| Compound Name | 7-fluoro-6-(4-iodo-2-methylanilino)-3-methylbenzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 58781096 |
| Molecular Formula | C16H15FIN5O |
| Molecular Weight | 439.23 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 7-fluoro-6-(4-iodo-2-methylanilino)-3-methylbenzimidazole-5-carbohydrazide |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)NN)cc2c(ncn2C)c1F |
| InChI | InChI=1S/C16H15FIN5O/c1-8-5-9(18)3-4-11(8)21-14-10(16(24)22-19)6-12-15(13(14)17)20-7-23(12)2/h3-7,21H,19H2,1-2H3,(H,22,24) |
| InChIKey | CQHREFJGDPQPEK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|