C16H13FIN3O2 — CID 58781122
7-fluoro-6-(4-iodo-2-methylanilino)-3-methylbenzimidazole-5-carboxylic acid (PubChem CID 58781122) has the molecular formula C16H13FIN3O2 and a molecular weight of 425.20 g/mol. Its IUPAC name is 7-fluoro-6-(4-iodo-2-methylanilino)-3-methylbenzimidazole-5-carboxylic acid.
| Compound Name | 7-fluoro-6-(4-iodo-2-methylanilino)-3-methylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 58781122 |
| Molecular Formula | C16H13FIN3O2 |
| Molecular Weight | 425.20 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 7-fluoro-6-(4-iodo-2-methylanilino)-3-methylbenzimidazole-5-carboxylic acid |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)O)cc2c(ncn2C)c1F |
| InChI | InChI=1S/C16H13FIN3O2/c1-8-5-9(18)3-4-11(8)20-14-10(16(22)23)6-12-15(13(14)17)19-7-21(12)2/h3-7,20H,1-2H3,(H,22,23) |
| InChIKey | QTQKSJMGWWERPX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.20 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|