C22H22F2IN3O3 — CID 22244041
3,4-difluoro-2-(4-iodo-2-methylanilino)-5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)benzoic acid (PubChem CID 22244041) has the molecular formula C22H22F2IN3O3 and a molecular weight of 541.34 g/mol. Its IUPAC name is 3,4-difluoro-2-(4-iodo-2-methylanilino)-5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)benzoic acid.
| Compound Name | 3,4-difluoro-2-(4-iodo-2-methylanilino)-5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 22244041 |
| Molecular Formula | C22H22F2IN3O3 |
| Molecular Weight | 541.34 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | 3,4-difluoro-2-(4-iodo-2-methylanilino)-5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)benzoic acid |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)O)cc(C(=O)N2CC3CN(C)CC3C2)c(F)c1F |
| InChI | InChI=1S/C22H22F2IN3O3/c1-11-5-14(25)3-4-17(11)26-20-16(22(30)31)6-15(18(23)19(20)24)21(29)28-9-12-7-27(2)8-13(12)10-28/h3-6,12-13,26H,7-10H2,1-2H3,(H,30,31) |
| InChIKey | LHZPLRNLPYHBMF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|