C21H21F2IN2O4 — CID 87903696
3,4-difluoro-5-[[(1S)-2-hydroxycyclohexyl]carbamoyl]-2-(4-iodo-2-methylanilino)benzoic acid (PubChem CID 87903696) has the molecular formula C21H21F2IN2O4 and a molecular weight of 530.31 g/mol. Its IUPAC name is 3,4-difluoro-5-[[(1S)-2-hydroxycyclohexyl]carbamoyl]-2-(4-iodo-2-methylanilino)benzoic acid.
| Compound Name | 3,4-difluoro-5-[[(1S)-2-hydroxycyclohexyl]carbamoyl]-2-(4-iodo-2-methylanilino)benzoic acid |
|---|---|
| PubChem CID | 87903696 |
| Molecular Formula | C21H21F2IN2O4 |
| Molecular Weight | 530.31 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | 3,4-difluoro-5-[[(1S)-2-hydroxycyclohexyl]carbamoyl]-2-(4-iodo-2-methylanilino)benzoic acid |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)O)cc(C(=O)N[C@H]2CCCCC2O)c(F)c1F |
| InChI | InChI=1S/C21H21F2IN2O4/c1-10-8-11(24)6-7-14(10)25-19-13(21(29)30)9-12(17(22)18(19)23)20(28)26-15-4-2-3-5-16(15)27/h6-9,15-16,25,27H,2-5H2,1H3,(H,26,28)(H,29,30)/t15-,16?/m0/s1 |
| InChIKey | CGAYEFHZESVPCP-VYRBHSGPSA-N |
| XLogP | 4.35 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|