C15H12F2INO — CID 23526715
1-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]ethanone (PubChem CID 23526715) has the molecular formula C15H12F2INO and a molecular weight of 387.17 g/mol. Its IUPAC name is 1-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]ethanone.
| Compound Name | 1-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]ethanone |
|---|---|
| PubChem CID | 23526715 |
| Molecular Formula | C15H12F2INO |
| Molecular Weight | 387.17 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 1-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(F)c(F)c1Nc1ccc(I)cc1C |
| InChI | InChI=1S/C15H12F2INO/c1-8-7-10(18)3-6-13(8)19-15-11(9(2)20)4-5-12(16)14(15)17/h3-7,19H,1-2H3 |
| InChIKey | PSKYZVRITWBLPU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.17 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|