C15H10F2IN3OS — CID 18614560
5-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]-3H-1,3,4-thiadiazol-2-one (PubChem CID 18614560) has the molecular formula C15H10F2IN3OS and a molecular weight of 445.23 g/mol. Its IUPAC name is 5-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]-3H-1,3,4-thiadiazol-2-one.
| Compound Name | 5-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]-3H-1,3,4-thiadiazol-2-one |
|---|---|
| PubChem CID | 18614560 |
| Molecular Formula | C15H10F2IN3OS |
| Molecular Weight | 445.23 g/mol |
| Exact Mass | 444.96 |
| IUPAC Name | 5-[3,4-difluoro-2-(4-iodo-2-methylanilino)phenyl]-3H-1,3,4-thiadiazol-2-one |
| SMILES | Cc1cc(I)ccc1Nc1c(-c2n[nH]c(=O)s2)ccc(F)c1F |
| InChI | InChI=1S/C15H10F2IN3OS/c1-7-6-8(18)2-5-11(7)19-13-9(3-4-10(16)12(13)17)14-20-21-15(22)23-14/h2-6,19H,1H3,(H,21,22) |
| InChIKey | ICFOZMCFRHMZKD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|