C16H13F2N3OS — CID 142007081
5-[2-(2,4-dimethylanilino)-3,4-difluorophenyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 142007081) has the molecular formula C16H13F2N3OS and a molecular weight of 333.36 g/mol. Its IUPAC name is 5-[2-(2,4-dimethylanilino)-3,4-difluorophenyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-(2,4-dimethylanilino)-3,4-difluorophenyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 142007081 |
| Molecular Formula | C16H13F2N3OS |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 5-[2-(2,4-dimethylanilino)-3,4-difluorophenyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1ccc(Nc2c(-c3n[nH]c(=S)o3)ccc(F)c2F)c(C)c1 |
| InChI | InChI=1S/C16H13F2N3OS/c1-8-3-6-12(9(2)7-8)19-14-10(4-5-11(17)13(14)18)15-20-21-16(23)22-15/h3-7,19H,1-2H3,(H,21,23) |
| InChIKey | NFZFAWHKRCTGJB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|