C21H12F7NO2 — CID 142108958
(2,3,4,5,6-pentafluorophenyl) 2-(2,4-dimethylanilino)-3,4-difluorobenzoate (PubChem CID 142108958) has the molecular formula C21H12F7NO2 and a molecular weight of 443.32 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-(2,4-dimethylanilino)-3,4-difluorobenzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-(2,4-dimethylanilino)-3,4-difluorobenzoate |
|---|---|
| PubChem CID | 142108958 |
| Molecular Formula | C21H12F7NO2 |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-(2,4-dimethylanilino)-3,4-difluorobenzoate |
| SMILES | Cc1ccc(Nc2c(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)ccc(F)c2F)c(C)c1 |
| InChI | InChI=1S/C21H12F7NO2/c1-8-3-6-12(9(2)7-8)29-19-10(4-5-11(22)13(19)23)21(30)31-20-17(27)15(25)14(24)16(26)18(20)28/h3-7,29H,1-2H3 |
| InChIKey | VFJGGKIFQPPXBL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|