C19H5F9INO2 — CID 23398481
(2,3,4,5,6-pentafluorophenyl) 3,4,5-trifluoro-2-(2-fluoro-4-iodoanilino)benzoate (PubChem CID 23398481) has the molecular formula C19H5F9INO2 and a molecular weight of 577.14 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3,4,5-trifluoro-2-(2-fluoro-4-iodoanilino)benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3,4,5-trifluoro-2-(2-fluoro-4-iodoanilino)benzoate |
|---|---|
| PubChem CID | 23398481 |
| Molecular Formula | C19H5F9INO2 |
| Molecular Weight | 577.14 g/mol |
| Exact Mass | 576.92 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3,4,5-trifluoro-2-(2-fluoro-4-iodoanilino)benzoate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1cc(F)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C19H5F9INO2/c20-7-3-5(29)1-2-9(7)30-17-6(4-8(21)10(22)14(17)26)19(31)32-18-15(27)12(24)11(23)13(25)16(18)28/h1-4,30H |
| InChIKey | GUSYBDKTOAIJJW-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.14 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|