C16H15F4NO2 — CID 142108942
ethane;3,4,5-trifluoro-2-(2-fluoro-4-methylanilino)benzoic acid (PubChem CID 142108942) has the molecular formula C16H15F4NO2 and a molecular weight of 329.29 g/mol. Its IUPAC name is ethane;3,4,5-trifluoro-2-(2-fluoro-4-methylanilino)benzoic acid.
| Compound Name | ethane;3,4,5-trifluoro-2-(2-fluoro-4-methylanilino)benzoic acid |
|---|---|
| PubChem CID | 142108942 |
| Molecular Formula | C16H15F4NO2 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | ethane;3,4,5-trifluoro-2-(2-fluoro-4-methylanilino)benzoic acid |
| SMILES | CC.Cc1ccc(Nc2c(C(=O)O)cc(F)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C14H9F4NO2.C2H6/c1-6-2-3-10(8(15)4-6)19-13-7(14(20)21)5-9(16)11(17)12(13)18;1-2/h2-5,19H,1H3,(H,20,21);1-2H3 |
| InChIKey | XPUMRCSCXKXRTE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|