C15H11F4NO — CID 176938927
1-[3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)phenyl]ethanone (PubChem CID 176938927) has the molecular formula C15H11F4NO and a molecular weight of 297.25 g/mol. Its IUPAC name is 1-[3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)phenyl]ethanone.
| Compound Name | 1-[3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)phenyl]ethanone |
|---|---|
| PubChem CID | 176938927 |
| Molecular Formula | C15H11F4NO |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-[3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)phenyl]ethanone |
| SMILES | CC(=O)c1c(F)cc(F)c(F)c1Nc1ccc(C)cc1F |
| InChI | InChI=1S/C15H11F4NO/c1-7-3-4-12(9(16)5-7)20-15-13(8(2)21)10(17)6-11(18)14(15)19/h3-6,20H,1-2H3 |
| InChIKey | OWYSRYWDNWISRW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|