C17H21F3N2 — CID 143399809
ethane;6-ethyl-3,4-difluoro-2-N-(2-fluoro-4-methylphenyl)benzene-1,2-diamine (PubChem CID 143399809) has the molecular formula C17H21F3N2 and a molecular weight of 310.36 g/mol. Its IUPAC name is ethane;6-ethyl-3,4-difluoro-2-N-(2-fluoro-4-methylphenyl)benzene-1,2-diamine.
| Compound Name | ethane;6-ethyl-3,4-difluoro-2-N-(2-fluoro-4-methylphenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 143399809 |
| Molecular Formula | C17H21F3N2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | ethane;6-ethyl-3,4-difluoro-2-N-(2-fluoro-4-methylphenyl)benzene-1,2-diamine |
| SMILES | CC.CCc1cc(F)c(F)c(Nc2ccc(C)cc2F)c1N |
| InChI | InChI=1S/C15H15F3N2.C2H6/c1-3-9-7-11(17)13(18)15(14(9)19)20-12-5-4-8(2)6-10(12)16;1-2/h4-7,20H,3,19H2,1-2H3;1-2H3 |
| InChIKey | ZKACEHICIFXBMW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|