C15H12F4N2O — CID 176938871
3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)-N-methylbenzamide (PubChem CID 176938871) has the molecular formula C15H12F4N2O and a molecular weight of 312.27 g/mol. Its IUPAC name is 3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)-N-methylbenzamide.
| Compound Name | 3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)-N-methylbenzamide |
|---|---|
| PubChem CID | 176938871 |
| Molecular Formula | C15H12F4N2O |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)-N-methylbenzamide |
| SMILES | CNC(=O)c1c(F)cc(F)c(F)c1Nc1ccc(C)cc1F |
| InChI | InChI=1S/C15H12F4N2O/c1-7-3-4-11(8(16)5-7)21-14-12(15(22)20-2)9(17)6-10(18)13(14)19/h3-6,21H,1-2H3,(H,20,22) |
| InChIKey | WKHNMGBNCMZVFL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|