C14H10F3IN2O — CID 122438576
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-methylbenzamide (PubChem CID 122438576) has the molecular formula C14H10F3IN2O and a molecular weight of 406.15 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-methylbenzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-methylbenzamide |
|---|---|
| PubChem CID | 122438576 |
| Molecular Formula | C14H10F3IN2O |
| Molecular Weight | 406.15 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C14H10F3IN2O/c1-19-14(21)8-3-4-9(15)12(17)13(8)20-11-5-2-7(18)6-10(11)16/h2-6,20H,1H3,(H,19,21) |
| InChIKey | WFMOCUXMSBKEJK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.15 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|