C18H16F3IN2O4 — CID 10229197
N-[(2,2-dimethyl-1,3-dioxolan-4-yl)oxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 10229197) has the molecular formula C18H16F3IN2O4 and a molecular weight of 508.23 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,3-dioxolan-4-yl)oxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)oxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 10229197 |
| Molecular Formula | C18H16F3IN2O4 |
| Molecular Weight | 508.23 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)oxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | CC1(C)OCC(ONC(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)O1 |
| InChI | InChI=1S/C18H16F3IN2O4/c1-18(2)26-8-14(27-18)28-24-17(25)10-4-5-11(19)15(21)16(10)23-13-6-3-9(22)7-12(13)20/h3-7,14,23H,8H2,1-2H3,(H,24,25) |
| InChIKey | MPOKLBSYEIQUCY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|