C17H16F3IN2O2 — CID 167361757
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-[(2-methylpropan-2-yl)oxy]benzamide (PubChem CID 167361757) has the molecular formula C17H16F3IN2O2 and a molecular weight of 464.23 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-[(2-methylpropan-2-yl)oxy]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-[(2-methylpropan-2-yl)oxy]benzamide |
|---|---|
| PubChem CID | 167361757 |
| Molecular Formula | C17H16F3IN2O2 |
| Molecular Weight | 464.23 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-[(2-methylpropan-2-yl)oxy]benzamide |
| SMILES | CC(C)(C)ONC(=O)c1ccc(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C17H16F3IN2O2/c1-17(2,3)25-23-16(24)10-5-6-11(18)14(20)15(10)22-13-7-4-9(21)8-12(13)19/h4-8,22H,1-3H3,(H,23,24) |
| InChIKey | REQJSKMVQSGJPQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|