C16H14F3IN2O3 — CID 175276663
N-(2,3-dihydroxypropyl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 175276663) has the molecular formula C16H14F3IN2O3 and a molecular weight of 466.20 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | N-(2,3-dihydroxypropyl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 175276663 |
| Molecular Formula | C16H14F3IN2O3 |
| Molecular Weight | 466.20 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | O=C(NCC(O)CO)c1ccc(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C16H14F3IN2O3/c17-11-3-2-10(16(25)21-6-9(24)7-23)15(14(11)19)22-13-4-1-8(20)5-12(13)18/h1-5,9,22-24H,6-7H2,(H,21,25) |
| InChIKey | BPIUFCYFHNBQFQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|