C15H16FIN4O3 — CID 90656538
N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)-2-methylpyrimidine-4-carboxamide (PubChem CID 90656538) has the molecular formula C15H16FIN4O3 and a molecular weight of 446.22 g/mol. Its IUPAC name is N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 90656538 |
| Molecular Formula | C15H16FIN4O3 |
| Molecular Weight | 446.22 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1ncc(Nc2ccc(I)cc2F)c(C(=O)NC[C@H](O)CO)n1 |
| InChI | InChI=1S/C15H16FIN4O3/c1-8-18-6-13(21-12-3-2-9(17)4-11(12)16)14(20-8)15(24)19-5-10(23)7-22/h2-4,6,10,21-23H,5,7H2,1H3,(H,19,24)/t10-/m0/s1 |
| InChIKey | OGVOOJOLLOWNCI-JTQLQIEISA-N |
| XLogP | 1.36 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|