C18H20FIN2O4S — CID 162352476
5-acetyl-N-[(2R)-2,4-dihydroxybutyl]-2-(2-fluoro-4-iodoanilino)-4-methylthiophene-3-carboxamide (PubChem CID 162352476) has the molecular formula C18H20FIN2O4S and a molecular weight of 506.34 g/mol. Its IUPAC name is 5-acetyl-N-[(2R)-2,4-dihydroxybutyl]-2-(2-fluoro-4-iodoanilino)-4-methylthiophene-3-carboxamide.
| Compound Name | 5-acetyl-N-[(2R)-2,4-dihydroxybutyl]-2-(2-fluoro-4-iodoanilino)-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 162352476 |
| Molecular Formula | C18H20FIN2O4S |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | 5-acetyl-N-[(2R)-2,4-dihydroxybutyl]-2-(2-fluoro-4-iodoanilino)-4-methylthiophene-3-carboxamide |
| SMILES | CC(=O)c1sc(Nc2ccc(I)cc2F)c(C(=O)NC[C@H](O)CCO)c1C |
| InChI | InChI=1S/C18H20FIN2O4S/c1-9-15(17(26)21-8-12(25)5-6-23)18(27-16(9)10(2)24)22-14-4-3-11(20)7-13(14)19/h3-4,7,12,22-23,25H,5-6,8H2,1-2H3,(H,21,26)/t12-/m1/s1 |
| InChIKey | WVSWHFGDITWABT-GFCCVEGCSA-N |
| XLogP | 3.22 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|